C13H16F3N5O — CID 146077873
4-[1-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]azetidin-3-yl]piperazin-2-one (PubChem CID 146077873) has the molecular formula C13H16F3N5O and a molecular weight of 315.30 g/mol. Its IUPAC name is 4-[1-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]azetidin-3-yl]piperazin-2-one.
| Compound Name | 4-[1-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]azetidin-3-yl]piperazin-2-one |
|---|---|
| PubChem CID | 146077873 |
| Molecular Formula | C13H16F3N5O |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-[1-[2-methyl-6-(trifluoromethyl)pyrimidin-4-yl]azetidin-3-yl]piperazin-2-one |
| SMILES | Cc1nc(N2CC(N3CCNC(=O)C3)C2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H16F3N5O/c1-8-18-10(13(14,15)16)4-11(19-8)21-5-9(6-21)20-3-2-17-12(22)7-20/h4,9H,2-3,5-7H2,1H3,(H,17,22) |
| InChIKey | JBFKYPBOHZSTLK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |