About 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide
2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide (PubChem CID 146078378) has the molecular formula C11H9F3N4OS
and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide |
| PubChem CID | 146078378 |
| Molecular Formula | C11H9F3N4OS |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ncc(C)s2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H9F3N4OS/c1-5-4-15-10(20-5)18-9(19)7-3-8(11(12,13)14)17-6(2)16-7/h3-4H,1-2H3,(H,15,18,19) |
| InChIKey | MBDFRPOHBDIBEX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide?
The IUPAC name of 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide (CID 146078378) is 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide.
What is the SMILES notation for 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide?
The canonical SMILES for 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide is Cc1nc(C(=O)Nc2ncc(C)s2)cc(C(F)(F)F)n1.
What is the InChIKey of 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide?
The InChIKey is MBDFRPOHBDIBEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N4OS/c1-5-4-15-10(20-5)18-9(19)7-3-8(11(12,13)14)17-6(2)16-7/h3-4H,1-2H3,(H,15,18,19).
What are the key properties of 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide?
2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide has a molecular weight of 302.28 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)-6-(trifluoromethyl)pyrimidine-4-carboxamide is sourced from PubChem (CID 146078378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).