C14H18ClNO3S2 — CID 146080294
5-chloro-N-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]-2-methoxybenzamide (PubChem CID 146080294) has the molecular formula C14H18ClNO3S2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 5-chloro-N-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 146080294 |
| Molecular Formula | C14H18ClNO3S2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 5-chloro-N-[(6-hydroxy-1,4-dithiepan-6-yl)methyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCC1(O)CSCCSC1 |
| InChI | InChI=1S/C14H18ClNO3S2/c1-19-12-3-2-10(15)6-11(12)13(17)16-7-14(18)8-20-4-5-21-9-14/h2-3,6,18H,4-5,7-9H2,1H3,(H,16,17) |
| InChIKey | PLZUUHPYFQYTLD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |