C11H20N2O3 — CID 146081999
tert-butyl (4aR,7aS)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine-4-carboxylate (PubChem CID 146081999) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is tert-butyl (4aR,7aS)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine-4-carboxylate.
| Compound Name | tert-butyl (4aR,7aS)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 146081999 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | tert-butyl (4aR,7aS)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C11H20N2O3/c1-11(2,3)16-10(14)13-5-4-12-8-6-15-7-9(8)13/h8-9,12H,4-7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | CTZAPXNYWJHZHJ-BDAKNGLRSA-N |
| XLogP | 0.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |