C9H18N2O2S — CID 146082032
3-(hydroxymethyl)-N-(2-methylsulfanylpropyl)azetidine-1-carboxamide (PubChem CID 146082032) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 3-(hydroxymethyl)-N-(2-methylsulfanylpropyl)azetidine-1-carboxamide.
| Compound Name | 3-(hydroxymethyl)-N-(2-methylsulfanylpropyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 146082032 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(hydroxymethyl)-N-(2-methylsulfanylpropyl)azetidine-1-carboxamide |
| SMILES | CSC(C)CNC(=O)N1CC(CO)C1 |
| InChI | InChI=1S/C9H18N2O2S/c1-7(14-2)3-10-9(13)11-4-8(5-11)6-12/h7-8,12H,3-6H2,1-2H3,(H,10,13) |
| InChIKey | HVMMUWACPGYGHS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |