C12H17N3O2 — CID 146082048
tert-butyl N-[(4-ethynyl-1-methylpyrazol-5-yl)methyl]carbamate (PubChem CID 146082048) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is tert-butyl N-[(4-ethynyl-1-methylpyrazol-5-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(4-ethynyl-1-methylpyrazol-5-yl)methyl]carbamate |
|---|---|
| PubChem CID | 146082048 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | tert-butyl N-[(4-ethynyl-1-methylpyrazol-5-yl)methyl]carbamate |
| SMILES | C#Cc1cnn(C)c1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H17N3O2/c1-6-9-7-14-15(5)10(9)8-13-11(16)17-12(2,3)4/h1,7H,8H2,2-5H3,(H,13,16) |
| InChIKey | LBALTHXTNOYDIT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|