About 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride
2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride (PubChem CID 146082221) has the molecular formula C7H12ClF2N
and a molecular weight of 183.63 g/mol. Its IUPAC name is 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride.
Molecular Properties
| Compound Name | 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride |
| PubChem CID | 146082221 |
| Molecular Formula | C7H12ClF2N |
| Molecular Weight | 183.63 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride |
| SMILES | Cl.FC1(F)CC2(CCNC2)C1 |
| InChI | InChI=1S/C7H11F2N.ClH/c8-7(9)3-6(4-7)1-2-10-5-6;/h10H,1-5H2;1H |
| InChIKey | VAUQHXIBZXNWBT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.63 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride?
The IUPAC name of 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride (CID 146082221) is 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride.
What is the SMILES notation for 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride?
The canonical SMILES for 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride is Cl.FC1(F)CC2(CCNC2)C1.
What is the InChIKey of 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride?
The InChIKey is VAUQHXIBZXNWBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2N.ClH/c8-7(9)3-6(4-7)1-2-10-5-6;/h10H,1-5H2;1H.
What are the key properties of 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride?
2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride has a molecular weight of 183.63 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-6-azaspiro[3.4]octane;hydrochloride is sourced from PubChem (CID 146082221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).