C11H19BO3 — CID 146082256
4,4,5,5-tetramethyl-2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]-1,3,2-dioxaborolane (PubChem CID 146082256) has the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 146082256 |
| Molecular Formula | C11H19BO3 |
| Molecular Weight | 210.08 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2[C@H]3COC[C@@H]23)OC1(C)C |
| InChI | InChI=1S/C11H19BO3/c1-10(2)11(3,4)15-12(14-10)9-7-5-13-6-8(7)9/h7-9H,5-6H2,1-4H3/t7-,8+,9? |
| InChIKey | HHJSEQDSZMCBIO-JVHMLUBASA-N |
| XLogP | 1.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.08 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|