About 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride
2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride (PubChem CID 146082417) has the molecular formula C6H11ClF3N
and a molecular weight of 189.61 g/mol. Its IUPAC name is 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride |
| PubChem CID | 146082417 |
| Molecular Formula | C6H11ClF3N |
| Molecular Weight | 189.61 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride |
| SMILES | Cl.NCC[C@@H]1C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C6H10F3N.ClH/c7-6(8,9)5-3-4(5)1-2-10;/h4-5H,1-3,10H2;1H/t4-,5-;/m1./s1 |
| InChIKey | FTRCFSXBUDVODA-TYSVMGFPSA-N |
| XLogP | 1.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.61 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride?
The IUPAC name of 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride (CID 146082417) is 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride.
What is the SMILES notation for 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride?
The canonical SMILES for 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride is Cl.NCC[C@@H]1C[C@H]1C(F)(F)F.
What is the InChIKey of 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride?
The InChIKey is FTRCFSXBUDVODA-TYSVMGFPSA-N. The full InChI is InChI=1S/C6H10F3N.ClH/c7-6(8,9)5-3-4(5)1-2-10;/h4-5H,1-3,10H2;1H/t4-,5-;/m1./s1.
What are the key properties of 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride?
2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride has a molecular weight of 189.61 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R)-2-(trifluoromethyl)cyclopropyl]ethanamine;hydrochloride is sourced from PubChem (CID 146082417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).