About 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide
5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide (PubChem CID 146082445) has the molecular formula C6H10Br2N2
and a molecular weight of 269.97 g/mol. Its IUPAC name is 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide.
Molecular Properties
| Compound Name | 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide |
| PubChem CID | 146082445 |
| Molecular Formula | C6H10Br2N2 |
| Molecular Weight | 269.97 g/mol |
| Exact Mass | 267.92 |
| IUPAC Name | 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide |
| SMILES | Br.Cc1ncn(C)c1CBr |
| InChI | InChI=1S/C6H9BrN2.BrH/c1-5-6(3-7)9(2)4-8-5;/h4H,3H2,1-2H3;1H |
| InChIKey | MMEGWAIPNNIRRM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.97 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide?
The IUPAC name of 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide (CID 146082445) is 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide.
What is the SMILES notation for 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide?
The canonical SMILES for 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide is Br.Cc1ncn(C)c1CBr.
What is the InChIKey of 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide?
The InChIKey is MMEGWAIPNNIRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN2.BrH/c1-5-6(3-7)9(2)4-8-5;/h4H,3H2,1-2H3;1H.
What are the key properties of 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide?
5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide has a molecular weight of 269.97 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-1,4-dimethylimidazole;hydrobromide is sourced from PubChem (CID 146082445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).