About trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide
trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide (PubChem CID 146082468) has the molecular formula C5H7F3N2O
and a molecular weight of 168.12 g/mol. Its IUPAC name is trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide.
Molecular Properties
| Compound Name | trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide |
| PubChem CID | 146082468 |
| Molecular Formula | C5H7F3N2O |
| Molecular Weight | 168.12 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide |
| SMILES | N/C(=N\O)[C@@H]1C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C5H7F3N2O/c6-5(7,8)3-1-2(3)4(9)10-11/h2-3,11H,1H2,(H2,9,10)/t2-,3-/m1/s1 |
| InChIKey | QNFBZXXCLBRWRZ-PWNYCUMCSA-N |
| XLogP | 0.93 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.12 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide?
The IUPAC name of trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide (CID 146082468) is trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide.
What is the SMILES notation for trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide?
The canonical SMILES for trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide is N/C(=N\O)[C@@H]1C[C@H]1C(F)(F)F.
What is the InChIKey of trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide?
The InChIKey is QNFBZXXCLBRWRZ-PWNYCUMCSA-N. The full InChI is InChI=1S/C5H7F3N2O/c6-5(7,8)3-1-2(3)4(9)10-11/h2-3,11H,1H2,(H2,9,10)/t2-,3-/m1/s1.
What are the key properties of trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide?
trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide has a molecular weight of 168.12 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-N'-hydroxy-2-(trifluoromethyl)cyclopropane-1-carboximidamide is sourced from PubChem (CID 146082468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).