About 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide
2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide (PubChem CID 146082823) has the molecular formula C10H17N3O3
and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide |
| PubChem CID | 146082823 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)Cn1c(C(C)C)noc1=O |
| InChI | InChI=1S/C10H17N3O3/c1-6(2)9-12-16-10(15)13(9)5-8(14)11-7(3)4/h6-7H,5H2,1-4H3,(H,11,14) |
| InChIKey | JMYBGXMVSQCBGW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide?
The IUPAC name of 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide (CID 146082823) is 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide.
What is the SMILES notation for 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide?
The canonical SMILES for 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide is CC(C)NC(=O)Cn1c(C(C)C)noc1=O.
What is the InChIKey of 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide?
The InChIKey is JMYBGXMVSQCBGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3/c1-6(2)9-12-16-10(15)13(9)5-8(14)11-7(3)4/h6-7H,5H2,1-4H3,(H,11,14).
What are the key properties of 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide?
2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide has a molecular weight of 227.26 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-3-propan-2-yl-1,2,4-oxadiazol-4-yl)-N-propan-2-ylacetamide is sourced from PubChem (CID 146082823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).