C17H19F3N4O4 — CID 146083828
2-[2-(1,3-dioxoisoindol-2-yl)ethyl-methylamino]-N-(2,2,2-trifluoroethylcarbamoyl)propanamide (PubChem CID 146083828) has the molecular formula C17H19F3N4O4 and a molecular weight of 400.36 g/mol. Its IUPAC name is 2-[2-(1,3-dioxoisoindol-2-yl)ethyl-methylamino]-N-(2,2,2-trifluoroethylcarbamoyl)propanamide.
| Compound Name | 2-[2-(1,3-dioxoisoindol-2-yl)ethyl-methylamino]-N-(2,2,2-trifluoroethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 146083828 |
| Molecular Formula | C17H19F3N4O4 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[2-(1,3-dioxoisoindol-2-yl)ethyl-methylamino]-N-(2,2,2-trifluoroethylcarbamoyl)propanamide |
| SMILES | CC(C(=O)NC(=O)NCC(F)(F)F)N(C)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H19F3N4O4/c1-10(13(25)22-16(28)21-9-17(18,19)20)23(2)7-8-24-14(26)11-5-3-4-6-12(11)15(24)27/h3-6,10H,7-9H2,1-2H3,(H2,21,22,25,28) |
| InChIKey | NUQQXXICQIRVJJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|