About 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide (PubChem CID 146085800) has the molecular formula C14H21N3O3S
and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide.
Molecular Properties
| Compound Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide |
| PubChem CID | 146085800 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide |
| SMILES | Cc1cncc(NC(=O)C(C(C)C)N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C14H21N3O3S/c1-10(2)13(17-5-4-6-21(17,19)20)14(18)16-12-7-11(3)8-15-9-12/h7-10,13H,4-6H2,1-3H3,(H,16,18) |
| InChIKey | HXHUBUCIGJJPJX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide?
The IUPAC name of 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide (CID 146085800) is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide.
What is the SMILES notation for 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide?
The canonical SMILES for 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide is Cc1cncc(NC(=O)C(C(C)C)N2CCCS2(=O)=O)c1.
What is the InChIKey of 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide?
The InChIKey is HXHUBUCIGJJPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3S/c1-10(2)13(17-5-4-6-21(17,19)20)14(18)16-12-7-11(3)8-15-9-12/h7-10,13H,4-6H2,1-3H3,(H,16,18).
What are the key properties of 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide?
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide has a molecular weight of 311.41 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-(5-methyl-3-pyridinyl)butanamide is sourced from PubChem (CID 146085800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).