C14H17ClN2O2 — CID 146085997
2-chloro-N-(5-methyl-2-oxo-1-phenylpyrrolidin-3-yl)propanamide (PubChem CID 146085997) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.76 g/mol. Its IUPAC name is 2-chloro-N-(5-methyl-2-oxo-1-phenylpyrrolidin-3-yl)propanamide.
| Compound Name | 2-chloro-N-(5-methyl-2-oxo-1-phenylpyrrolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 146085997 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-chloro-N-(5-methyl-2-oxo-1-phenylpyrrolidin-3-yl)propanamide |
| SMILES | CC(Cl)C(=O)NC1CC(C)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C14H17ClN2O2/c1-9-8-12(16-13(18)10(2)15)14(19)17(9)11-6-4-3-5-7-11/h3-7,9-10,12H,8H2,1-2H3,(H,16,18) |
| InChIKey | DEOBTTJJJFEDPT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|