C17H23NO4 — CID 14608607
methyl (3R,4Z,6Z,8E)-3-hydroxy-2,2,4-trimethyl-10-(1,3-oxazol-5-yl)deca-4,6,8-trienoate (PubChem CID 14608607) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is methyl (3R,4Z,6Z,8E)-3-hydroxy-2,2,4-trimethyl-10-(1,3-oxazol-5-yl)deca-4,6,8-trienoate.
| Compound Name | methyl (3R,4Z,6Z,8E)-3-hydroxy-2,2,4-trimethyl-10-(1,3-oxazol-5-yl)deca-4,6,8-trienoate |
|---|---|
| PubChem CID | 14608607 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | methyl (3R,4Z,6Z,8E)-3-hydroxy-2,2,4-trimethyl-10-(1,3-oxazol-5-yl)deca-4,6,8-trienoate |
| SMILES | COC(=O)C(C)(C)[C@H](O)/C(C)=C\C=C/C=C/Cc1cnco1 |
| InChI | InChI=1S/C17H23NO4/c1-13(15(19)17(2,3)16(20)21-4)9-7-5-6-8-10-14-11-18-12-22-14/h5-9,11-12,15,19H,10H2,1-4H3/b7-5-,8-6+,13-9-/t15-/m1/s1 |
| InChIKey | NWDTXLYPSKCNJG-HVXKYVLISA-N |
| XLogP | 2.84 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|