C18H18Cl2N4O — CID 146086281
(6,8-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1,3,5-trimethylpyrazol-4-yl)methanone (PubChem CID 146086281) has the molecular formula C18H18Cl2N4O and a molecular weight of 377.28 g/mol. Its IUPAC name is (6,8-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1,3,5-trimethylpyrazol-4-yl)methanone.
| Compound Name | (6,8-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1,3,5-trimethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 146086281 |
| Molecular Formula | C18H18Cl2N4O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (6,8-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1,3,5-trimethylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C)c(C)c1C(=O)N1CCc2[nH]c3c(Cl)cc(Cl)cc3c2C1 |
| InChI | InChI=1S/C18H18Cl2N4O/c1-9-16(10(2)23(3)22-9)18(25)24-5-4-15-13(8-24)12-6-11(19)7-14(20)17(12)21-15/h6-7,21H,4-5,8H2,1-3H3 |
| InChIKey | IZNMSQDEENAFCZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|