C20H22N4O2S — CID 146086421
5-amino-1-benzyl-3-methyl-N-[(4-methylsulfinylphenyl)methyl]pyrazole-4-carboxamide (PubChem CID 146086421) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 5-amino-1-benzyl-3-methyl-N-[(4-methylsulfinylphenyl)methyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-benzyl-3-methyl-N-[(4-methylsulfinylphenyl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 146086421 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 5-amino-1-benzyl-3-methyl-N-[(4-methylsulfinylphenyl)methyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c(N)c1C(=O)NCc1ccc(S(C)=O)cc1 |
| InChI | InChI=1S/C20H22N4O2S/c1-14-18(19(21)24(23-14)13-16-6-4-3-5-7-16)20(25)22-12-15-8-10-17(11-9-15)27(2)26/h3-11H,12-13,21H2,1-2H3,(H,22,25) |
| InChIKey | QUDBNPRARICTOF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |