C30H64O6Si2 — CID 14608677
[5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate (PubChem CID 14608677) has the molecular formula C30H64O6Si2 and a molecular weight of 577.01 g/mol. Its IUPAC name is [5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate.
| Compound Name | [5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14608677 |
| Molecular Formula | C30H64O6Si2 |
| Molecular Weight | 577.01 g/mol |
| Exact Mass | 576.42 |
| IUPAC Name | [5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate |
| SMILES | COC(CC(C)COC(=O)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(CC(C)CO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C30H64O6Si2/c1-22(20-34-27(31)28(3,4)5)18-24(32-12)26(36-38(16,17)30(9,10)11)25(33-13)19-23(2)21-35-37(14,15)29(6,7)8/h22-26H,18-21H2,1-17H3 |
| InChIKey | CKSKQNJKKTVSNQ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.01 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|