C28H60O5Si2 — CID 14608699
5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethyl-9-tri(propan-2-yl)silyloxynonanal (PubChem CID 14608699) has the molecular formula C28H60O5Si2 and a molecular weight of 532.96 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethyl-9-tri(propan-2-yl)silyloxynonanal.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethyl-9-tri(propan-2-yl)silyloxynonanal |
|---|---|
| PubChem CID | 14608699 |
| Molecular Formula | C28H60O5Si2 |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.40 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethyl-9-tri(propan-2-yl)silyloxynonanal |
| SMILES | COC(CC(C)C=O)C(O[Si](C)(C)C(C)(C)C)C(CC(C)CO[Si](C(C)C)(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C28H60O5Si2/c1-20(2)35(21(3)4,22(5)6)32-19-24(8)17-26(31-13)27(25(30-12)16-23(7)18-29)33-34(14,15)28(9,10)11/h18,20-27H,16-17,19H2,1-15H3 |
| InChIKey | WWBBUANBOACRPQ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|