C11H14F3N3O3 — CID 146087094
7-(5,5,5-trifluoropentanoyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 146087094) has the molecular formula C11H14F3N3O3 and a molecular weight of 293.25 g/mol. Its IUPAC name is 7-(5,5,5-trifluoropentanoyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 7-(5,5,5-trifluoropentanoyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 146087094 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 7-(5,5,5-trifluoropentanoyl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | O=C1NC(=O)N2CCN(C(=O)CCCC(F)(F)F)CC12 |
| InChI | InChI=1S/C11H14F3N3O3/c12-11(13,14)3-1-2-8(18)16-4-5-17-7(6-16)9(19)15-10(17)20/h7H,1-6H2,(H,15,19,20) |
| InChIKey | FMRMXNPHGPFFDB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|