About [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone
[2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone (PubChem CID 146087168) has the molecular formula C22H19F2N3O3
and a molecular weight of 411.41 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone.
Molecular Properties
| Compound Name | [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone |
| PubChem CID | 146087168 |
| Molecular Formula | C22H19F2N3O3 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone |
| SMILES | O=C(c1cnc(OCc2ccccc2)cn1)N1CC(O)CC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H19F2N3O3/c23-17-7-6-15(8-18(17)24)20-9-16(28)12-27(20)22(29)19-10-26-21(11-25-19)30-13-14-4-2-1-3-5-14/h1-8,10-11,16,20,28H,9,12-13H2 |
| InChIKey | XGRMUHRWMOJXDJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone?
The IUPAC name of [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone (CID 146087168) is [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone.
What is the SMILES notation for [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone?
The canonical SMILES for [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone is O=C(c1cnc(OCc2ccccc2)cn1)N1CC(O)CC1c1ccc(F)c(F)c1.
What is the InChIKey of [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone?
The InChIKey is XGRMUHRWMOJXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2N3O3/c23-17-7-6-15(8-18(17)24)20-9-16(28)12-27(20)22(29)19-10-26-21(11-25-19)30-13-14-4-2-1-3-5-14/h1-8,10-11,16,20,28H,9,12-13H2.
What are the key properties of [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone?
[2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone has a molecular weight of 411.41 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-(5-phenylmethoxypyrazin-2-yl)methanone is sourced from PubChem (CID 146087168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).