C18H24N4O2 — CID 146087761
N'-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-N-ethylbutanediamide (PubChem CID 146087761) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N'-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-N-ethylbutanediamide.
| Compound Name | N'-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-N-ethylbutanediamide |
|---|---|
| PubChem CID | 146087761 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N'-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-N-ethylbutanediamide |
| SMILES | CCNC(=O)CCC(=O)Nc1cccc(Cn2nc(C)cc2C)c1 |
| InChI | InChI=1S/C18H24N4O2/c1-4-19-17(23)8-9-18(24)20-16-7-5-6-15(11-16)12-22-14(3)10-13(2)21-22/h5-7,10-11H,4,8-9,12H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | SKGLNZBFKLNPAZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |