C17H14N2O2 — CID 146087793
3'-phenylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione (PubChem CID 146087793) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3'-phenylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-phenylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 146087793 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3'-phenylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(Cc3ccccc3C2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C17H14N2O2/c20-15-17(10-12-6-4-5-7-13(12)11-17)18-16(21)19(15)14-8-2-1-3-9-14/h1-9H,10-11H2,(H,18,21) |
| InChIKey | WUUJJICZVHKXRV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|