C21H19FN2O6S — CID 146089664
(2,6-dioxopiperidin-3-yl) 2-fluoro-5-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate (PubChem CID 146089664) has the molecular formula C21H19FN2O6S and a molecular weight of 446.46 g/mol. Its IUPAC name is (2,6-dioxopiperidin-3-yl) 2-fluoro-5-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate.
| Compound Name | (2,6-dioxopiperidin-3-yl) 2-fluoro-5-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate |
|---|---|
| PubChem CID | 146089664 |
| Molecular Formula | C21H19FN2O6S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | (2,6-dioxopiperidin-3-yl) 2-fluoro-5-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate |
| SMILES | CC1Cc2ccccc2N1S(=O)(=O)c1ccc(F)c(C(=O)OC2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C21H19FN2O6S/c1-12-10-13-4-2-3-5-17(13)24(12)31(28,29)14-6-7-16(22)15(11-14)21(27)30-18-8-9-19(25)23-20(18)26/h2-7,11-12,18H,8-10H2,1H3,(H,23,25,26) |
| InChIKey | DLZBGMMPBADURT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|