C18H18N6O2 — CID 146089996
5-ethyl-3-[3-(imidazo[1,2-a]pyrazin-3-ylmethylamino)phenyl]imidazolidine-2,4-dione (PubChem CID 146089996) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 5-ethyl-3-[3-(imidazo[1,2-a]pyrazin-3-ylmethylamino)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-3-[3-(imidazo[1,2-a]pyrazin-3-ylmethylamino)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146089996 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 5-ethyl-3-[3-(imidazo[1,2-a]pyrazin-3-ylmethylamino)phenyl]imidazolidine-2,4-dione |
| SMILES | CCC1NC(=O)N(c2cccc(NCc3cnc4cnccn34)c2)C1=O |
| InChI | InChI=1S/C18H18N6O2/c1-2-15-17(25)24(18(26)22-15)13-5-3-4-12(8-13)20-9-14-10-21-16-11-19-6-7-23(14)16/h3-8,10-11,15,20H,2,9H2,1H3,(H,22,26) |
| InChIKey | SFANOYUYSUXXGV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|