About N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide
N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide (PubChem CID 146091041) has the molecular formula C13H19N3O3
and a molecular weight of 265.31 g/mol. Its IUPAC name is N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide |
| PubChem CID | 146091041 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide |
| SMILES | CN(C)c1ncccc1N(C)C(=O)C1COCCO1 |
| InChI | InChI=1S/C13H19N3O3/c1-15(2)12-10(5-4-6-14-12)16(3)13(17)11-9-18-7-8-19-11/h4-6,11H,7-9H2,1-3H3 |
| InChIKey | BYQGNAZEPGRIQU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide?
The IUPAC name of N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide (CID 146091041) is N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide.
What is the SMILES notation for N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide?
The canonical SMILES for N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide is CN(C)c1ncccc1N(C)C(=O)C1COCCO1.
What is the InChIKey of N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide?
The InChIKey is BYQGNAZEPGRIQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O3/c1-15(2)12-10(5-4-6-14-12)16(3)13(17)11-9-18-7-8-19-11/h4-6,11H,7-9H2,1-3H3.
What are the key properties of N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide?
N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide has a molecular weight of 265.31 g/mol, XLogP of 0.53, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)-3-pyridinyl]-N-methyl-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 146091041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).