C13H20N4O3 — CID 146091052
1-[(4-hydroxyoxan-4-yl)methyl]-1-methyl-3-(2-methylpyrimidin-4-yl)urea (PubChem CID 146091052) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-[(4-hydroxyoxan-4-yl)methyl]-1-methyl-3-(2-methylpyrimidin-4-yl)urea.
| Compound Name | 1-[(4-hydroxyoxan-4-yl)methyl]-1-methyl-3-(2-methylpyrimidin-4-yl)urea |
|---|---|
| PubChem CID | 146091052 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-[(4-hydroxyoxan-4-yl)methyl]-1-methyl-3-(2-methylpyrimidin-4-yl)urea |
| SMILES | Cc1nccc(NC(=O)N(C)CC2(O)CCOCC2)n1 |
| InChI | InChI=1S/C13H20N4O3/c1-10-14-6-3-11(15-10)16-12(18)17(2)9-13(19)4-7-20-8-5-13/h3,6,19H,4-5,7-9H2,1-2H3,(H,14,15,16,18) |
| InChIKey | QSZLXFPCCXIGTR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |