C17H22INO5 — CID 146091132
2-[(2-iodo-4,5-dimethoxybenzoyl)amino]-2-methylcyclohexane-1-carboxylic acid (PubChem CID 146091132) has the molecular formula C17H22INO5 and a molecular weight of 447.27 g/mol. Its IUPAC name is 2-[(2-iodo-4,5-dimethoxybenzoyl)amino]-2-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[(2-iodo-4,5-dimethoxybenzoyl)amino]-2-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 146091132 |
| Molecular Formula | C17H22INO5 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 2-[(2-iodo-4,5-dimethoxybenzoyl)amino]-2-methylcyclohexane-1-carboxylic acid |
| SMILES | COc1cc(I)c(C(=O)NC2(C)CCCCC2C(=O)O)cc1OC |
| InChI | InChI=1S/C17H22INO5/c1-17(7-5-4-6-11(17)16(21)22)19-15(20)10-8-13(23-2)14(24-3)9-12(10)18/h8-9,11H,4-7H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | FZVGNWDOTWLHKI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|