About 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine
5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine (PubChem CID 146091134) has the molecular formula C11H14ClN5O
and a molecular weight of 267.72 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine |
| PubChem CID | 146091134 |
| Molecular Formula | C11H14ClN5O |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine |
| SMILES | COc1ncc(Cl)c(Nc2c(C)nn(C)c2C)n1 |
| InChI | InChI=1S/C11H14ClN5O/c1-6-9(7(2)17(3)16-6)14-10-8(12)5-13-11(15-10)18-4/h5H,1-4H3,(H,13,14,15) |
| InChIKey | HJVNGGHIQALAMP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine?
The IUPAC name of 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine (CID 146091134) is 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine.
What is the SMILES notation for 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine?
The canonical SMILES for 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine is COc1ncc(Cl)c(Nc2c(C)nn(C)c2C)n1.
What is the InChIKey of 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine?
The InChIKey is HJVNGGHIQALAMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN5O/c1-6-9(7(2)17(3)16-6)14-10-8(12)5-13-11(15-10)18-4/h5H,1-4H3,(H,13,14,15).
What are the key properties of 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine?
5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine has a molecular weight of 267.72 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)pyrimidin-4-amine is sourced from PubChem (CID 146091134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).