C17H23Cl2N3O3 — CID 146091593
N-butan-2-yl-2-[4-(2,4-dichloro-6-hydroxybenzoyl)piperazin-1-yl]acetamide (PubChem CID 146091593) has the molecular formula C17H23Cl2N3O3 and a molecular weight of 388.30 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-(2,4-dichloro-6-hydroxybenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[4-(2,4-dichloro-6-hydroxybenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 146091593 |
| Molecular Formula | C17H23Cl2N3O3 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-butan-2-yl-2-[4-(2,4-dichloro-6-hydroxybenzoyl)piperazin-1-yl]acetamide |
| SMILES | CCC(C)NC(=O)CN1CCN(C(=O)c2c(O)cc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H23Cl2N3O3/c1-3-11(2)20-15(24)10-21-4-6-22(7-5-21)17(25)16-13(19)8-12(18)9-14(16)23/h8-9,11,23H,3-7,10H2,1-2H3,(H,20,24) |
| InChIKey | TYFKGNQANXKOAB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |