C17H20N6S — CID 146091931
3-[[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-1-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 146091931) has the molecular formula C17H20N6S and a molecular weight of 340.46 g/mol. Its IUPAC name is 3-[[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-1-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-1-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 146091931 |
| Molecular Formula | C17H20N6S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[[3-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazol-1-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1ccc(CSc2ncn(Cc3nnc4n3CCCC4)n2)cc1 |
| InChI | InChI=1S/C17H20N6S/c1-13-5-7-14(8-6-13)11-24-17-18-12-22(21-17)10-16-20-19-15-4-2-3-9-23(15)16/h5-8,12H,2-4,9-11H2,1H3 |
| InChIKey | MQTWMYPPGUXJLC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |