About N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine
N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 146092004) has the molecular formula C11H14F2N6
and a molecular weight of 268.27 g/mol. Its IUPAC name is N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 146092004 |
| Molecular Formula | C11H14F2N6 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | FC1(F)CCCCC1CNc1ccc2nnnn2n1 |
| InChI | InChI=1S/C11H14F2N6/c12-11(13)6-2-1-3-8(11)7-14-9-4-5-10-15-17-18-19(10)16-9/h4-5,8H,1-3,6-7H2,(H,14,16) |
| InChIKey | HLGGWKZQGZAIBG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine (CID 146092004) is N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine is FC1(F)CCCCC1CNc1ccc2nnnn2n1.
What is the InChIKey of N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is HLGGWKZQGZAIBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N6/c12-11(13)6-2-1-3-8(11)7-14-9-4-5-10-15-17-18-19(10)16-9/h4-5,8H,1-3,6-7H2,(H,14,16).
What are the key properties of N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine?
N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 268.27 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,2-difluorocyclohexyl)methyl]tetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 146092004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).