C15H24N2O5S — CID 146092896
4-[[[2-[(1-methylsulfanylcyclobutyl)methylamino]-2-oxoacetyl]amino]methyl]oxane-4-carboxylic acid (PubChem CID 146092896) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 4-[[[2-[(1-methylsulfanylcyclobutyl)methylamino]-2-oxoacetyl]amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[[2-[(1-methylsulfanylcyclobutyl)methylamino]-2-oxoacetyl]amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 146092896 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-[[[2-[(1-methylsulfanylcyclobutyl)methylamino]-2-oxoacetyl]amino]methyl]oxane-4-carboxylic acid |
| SMILES | CSC1(CNC(=O)C(=O)NCC2(C(=O)O)CCOCC2)CCC1 |
| InChI | InChI=1S/C15H24N2O5S/c1-23-15(3-2-4-15)10-17-12(19)11(18)16-9-14(13(20)21)5-7-22-8-6-14/h2-10H2,1H3,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | UHNBSTGYRWQUDJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|