C17H23N5O — CID 146092953
1-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-3-(1,2,3,4-tetrahydroquinolin-3-yl)urea (PubChem CID 146092953) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 1-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-3-(1,2,3,4-tetrahydroquinolin-3-yl)urea.
| Compound Name | 1-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-3-(1,2,3,4-tetrahydroquinolin-3-yl)urea |
|---|---|
| PubChem CID | 146092953 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-3-(1,2,3,4-tetrahydroquinolin-3-yl)urea |
| SMILES | Cc1[nH]ncc1CCCNC(=O)NC1CNc2ccccc2C1 |
| InChI | InChI=1S/C17H23N5O/c1-12-14(10-20-22-12)6-4-8-18-17(23)21-15-9-13-5-2-3-7-16(13)19-11-15/h2-3,5,7,10,15,19H,4,6,8-9,11H2,1H3,(H,20,22)(H2,18,21,23) |
| InChIKey | BDQMDEHASDPPBA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|