C19H22ClN5O2 — CID 146093479
(5R,7S)-N-[(6-chloroimidazo[1,2-a]pyridin-3-yl)methyl]-N,2,5,7-tetramethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide (PubChem CID 146093479) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is (5R,7S)-N-[(6-chloroimidazo[1,2-a]pyridin-3-yl)methyl]-N,2,5,7-tetramethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-[(6-chloroimidazo[1,2-a]pyridin-3-yl)methyl]-N,2,5,7-tetramethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146093479 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (5R,7S)-N-[(6-chloroimidazo[1,2-a]pyridin-3-yl)methyl]-N,2,5,7-tetramethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(nn(C)c2C(=O)N(C)Cc2cnc3ccc(Cl)cn23)[C@H](C)O1 |
| InChI | InChI=1S/C19H22ClN5O2/c1-11-7-15-17(12(2)27-11)22-24(4)18(15)19(26)23(3)10-14-8-21-16-6-5-13(20)9-25(14)16/h5-6,8-9,11-12H,7,10H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | UIHTURUFIFWSPV-NEPJUHHUSA-N |
| XLogP | 3.02 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |