C17H21F3N6O2 — CID 146093534
(5R,7S)-2,5,7-trimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide (PubChem CID 146093534) has the molecular formula C17H21F3N6O2 and a molecular weight of 398.39 g/mol. Its IUPAC name is (5R,7S)-2,5,7-trimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-2,5,7-trimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146093534 |
| Molecular Formula | C17H21F3N6O2 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (5R,7S)-2,5,7-trimethyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(nn(C)c2C(=O)NCCNc2nccc(C(F)(F)F)n2)[C@H](C)O1 |
| InChI | InChI=1S/C17H21F3N6O2/c1-9-8-11-13(10(2)28-9)25-26(3)14(11)15(27)21-6-7-23-16-22-5-4-12(24-16)17(18,19)20/h4-5,9-10H,6-8H2,1-3H3,(H,21,27)(H,22,23,24)/t9-,10+/m1/s1 |
| InChIKey | UIDJNQPLIPQSPT-ZJUUUORDSA-N |
| XLogP | 2.09 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|