C20H27N5O2 — CID 146093592
[5-(dimethylamino)-3,4-dihydro-1H-2,6-naphthyridin-2-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone (PubChem CID 146093592) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is [5-(dimethylamino)-3,4-dihydro-1H-2,6-naphthyridin-2-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone.
| Compound Name | [5-(dimethylamino)-3,4-dihydro-1H-2,6-naphthyridin-2-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 146093592 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | [5-(dimethylamino)-3,4-dihydro-1H-2,6-naphthyridin-2-yl]-[(5R,7S)-2,5,7-trimethyl-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-3-yl]methanone |
| SMILES | C[C@@H]1Cc2c(nn(C)c2C(=O)N2CCc3c(ccnc3N(C)C)C2)[C@H](C)O1 |
| InChI | InChI=1S/C20H27N5O2/c1-12-10-16-17(13(2)27-12)22-24(5)18(16)20(26)25-9-7-15-14(11-25)6-8-21-19(15)23(3)4/h6,8,12-13H,7,9-11H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | FSBBSMNWIXADSZ-OLZOCXBDSA-N |
| XLogP | 2.10 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |