About 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide
1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide (PubChem CID 146094195) has the molecular formula C19H32N4O5S2
and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide |
| PubChem CID | 146094195 |
| Molecular Formula | C19H32N4O5S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide |
| SMILES | O=S1(=O)CCC(N(CCCN2CCOCC2)S(=O)(=O)c2cnn(C3CCCC3)c2)C1 |
| InChI | InChI=1S/C19H32N4O5S2/c24-29(25)13-6-18(16-29)23(8-3-7-21-9-11-28-12-10-21)30(26,27)19-14-20-22(15-19)17-4-1-2-5-17/h14-15,17-18H,1-13,16H2 |
| InChIKey | XUAWEOAOIJUHIU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide?
The IUPAC name of 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide (CID 146094195) is 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide.
What is the SMILES notation for 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide?
The canonical SMILES for 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide is O=S1(=O)CCC(N(CCCN2CCOCC2)S(=O)(=O)c2cnn(C3CCCC3)c2)C1.
What is the InChIKey of 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide?
The InChIKey is XUAWEOAOIJUHIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N4O5S2/c24-29(25)13-6-18(16-29)23(8-3-7-21-9-11-28-12-10-21)30(26,27)19-14-20-22(15-19)17-4-1-2-5-17/h14-15,17-18H,1-13,16H2.
What are the key properties of 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide?
1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide has a molecular weight of 460.62 g/mol, XLogP of 0.90, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)pyrazole-4-sulfonamide is sourced from PubChem (CID 146094195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).