C19H17BrN2OS — CID 146094803
N-[1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]ethyl]-2-methylbenzamide (PubChem CID 146094803) has the molecular formula C19H17BrN2OS and a molecular weight of 401.33 g/mol. Its IUPAC name is N-[1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]ethyl]-2-methylbenzamide.
| Compound Name | N-[1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 146094803 |
| Molecular Formula | C19H17BrN2OS |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | N-[1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]ethyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC(C)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C19H17BrN2OS/c1-12-5-3-4-6-16(12)18(23)21-13(2)19-22-17(11-24-19)14-7-9-15(20)10-8-14/h3-11,13H,1-2H3,(H,21,23) |
| InChIKey | JXPKFAFTCRBODJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |