C16H22ClN3O2 — CID 146095016
2-chloro-1-[(3S)-3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]propan-1-one (PubChem CID 146095016) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 2-chloro-1-[(3S)-3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 2-chloro-1-[(3S)-3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 146095016 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-chloro-1-[(3S)-3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]propan-1-one |
| SMILES | CC(Cl)C(=O)N1CC[C@H](Oc2cccnc2N2CCCC2)C1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-12(17)16(21)20-10-6-13(11-20)22-14-5-4-7-18-15(14)19-8-2-3-9-19/h4-5,7,12-13H,2-3,6,8-11H2,1H3/t12?,13-/m0/s1 |
| InChIKey | IFFKFDXYBJVBQJ-ABLWVSNPSA-N |
| XLogP | 2.29 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|