About (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone
(5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone (PubChem CID 146095430) has the molecular formula C14H14N4O3
and a molecular weight of 286.29 g/mol. Its IUPAC name is (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone.
Molecular Properties
| Compound Name | (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone |
| PubChem CID | 146095430 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone |
| SMILES | COc1ccc(-c2ocnc2C(=O)N2CC=C(N)N2)cc1 |
| InChI | InChI=1S/C14H14N4O3/c1-20-10-4-2-9(3-5-10)13-12(16-8-21-13)14(19)18-7-6-11(15)17-18/h2-6,8,17H,7,15H2,1H3 |
| InChIKey | VKNXJEHTZICMOW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone?
The IUPAC name of (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone (CID 146095430) is (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone.
What is the SMILES notation for (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone?
The canonical SMILES for (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone is COc1ccc(-c2ocnc2C(=O)N2CC=C(N)N2)cc1.
What is the InChIKey of (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone?
The InChIKey is VKNXJEHTZICMOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O3/c1-20-10-4-2-9(3-5-10)13-12(16-8-21-13)14(19)18-7-6-11(15)17-18/h2-6,8,17H,7,15H2,1H3.
What are the key properties of (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone?
(5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone has a molecular weight of 286.29 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-1,3-dihydropyrazol-2-yl)-[5-(4-methoxyphenyl)-1,3-oxazol-4-yl]methanone is sourced from PubChem (CID 146095430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).