C20H22FN3O3 — CID 146095622
2-(3-fluoro-2-nitrophenyl)-N-[2-(2-methylpropyl)-1,3-dihydroisoindol-4-yl]acetamide (PubChem CID 146095622) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-(3-fluoro-2-nitrophenyl)-N-[2-(2-methylpropyl)-1,3-dihydroisoindol-4-yl]acetamide.
| Compound Name | 2-(3-fluoro-2-nitrophenyl)-N-[2-(2-methylpropyl)-1,3-dihydroisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 146095622 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-(3-fluoro-2-nitrophenyl)-N-[2-(2-methylpropyl)-1,3-dihydroisoindol-4-yl]acetamide |
| SMILES | CC(C)CN1Cc2cccc(NC(=O)Cc3cccc(F)c3[N+](=O)[O-])c2C1 |
| InChI | InChI=1S/C20H22FN3O3/c1-13(2)10-23-11-15-6-4-8-18(16(15)12-23)22-19(25)9-14-5-3-7-17(21)20(14)24(26)27/h3-8,13H,9-12H2,1-2H3,(H,22,25) |
| InChIKey | OERYHZGFUNMBRL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|