C16H29NO6 — CID 14609568
tert-butyl (4R)-4-[(Z,1S)-1-hydroxy-4,4-dimethoxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 14609568) has the molecular formula C16H29NO6 and a molecular weight of 331.41 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(Z,1S)-1-hydroxy-4,4-dimethoxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(Z,1S)-1-hydroxy-4,4-dimethoxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 14609568 |
| Molecular Formula | C16H29NO6 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | tert-butyl (4R)-4-[(Z,1S)-1-hydroxy-4,4-dimethoxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(/C=C\[C@H](O)[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C16H29NO6/c1-15(2,3)23-14(19)17-11(10-22-16(17,4)5)12(18)8-9-13(20-6)21-7/h8-9,11-13,18H,10H2,1-7H3/b9-8-/t11-,12+/m1/s1 |
| InChIKey | CPSGXTNVNRVDEM-STNFYNBXSA-N |
| XLogP | 1.89 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|