C24H19N3O4 — CID 146096199
1-(1,3-dioxoisoindol-5-yl)-3-[(2S,4R)-2-phenyl-3,4-dihydro-2H-chromen-4-yl]urea (PubChem CID 146096199) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-(1,3-dioxoisoindol-5-yl)-3-[(2S,4R)-2-phenyl-3,4-dihydro-2H-chromen-4-yl]urea.
| Compound Name | 1-(1,3-dioxoisoindol-5-yl)-3-[(2S,4R)-2-phenyl-3,4-dihydro-2H-chromen-4-yl]urea |
|---|---|
| PubChem CID | 146096199 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 1-(1,3-dioxoisoindol-5-yl)-3-[(2S,4R)-2-phenyl-3,4-dihydro-2H-chromen-4-yl]urea |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NC2=O)N[C@@H]1C[C@@H](c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C24H19N3O4/c28-22-16-11-10-15(12-18(16)23(29)27-22)25-24(30)26-19-13-21(14-6-2-1-3-7-14)31-20-9-5-4-8-17(19)20/h1-12,19,21H,13H2,(H2,25,26,30)(H,27,28,29)/t19-,21+/m1/s1 |
| InChIKey | SCCUCHMCCVFOLY-CTNGQTDRSA-N |
| XLogP | 3.96 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|