About N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide
N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide (PubChem CID 14609651) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide |
| PubChem CID | 14609651 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC(O)C(O)CC1=O |
| InChI | InChI=1S/C8H11NO4/c1-4(10)9-5-2-7(12)8(13)3-6(5)11/h2,7-8,12-13H,3H2,1H3,(H,9,10) |
| InChIKey | IXJGDLQDYQZOBH-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide?
The IUPAC name of N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide (CID 14609651) is N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide.
What is the SMILES notation for N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide?
The canonical SMILES for N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide is CC(=O)NC1=CC(O)C(O)CC1=O.
What is the InChIKey of N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide?
The InChIKey is IXJGDLQDYQZOBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4/c1-4(10)9-5-2-7(12)8(13)3-6(5)11/h2,7-8,12-13H,3H2,1H3,(H,9,10).
What are the key properties of N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide?
N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide has a molecular weight of 185.18 g/mol, XLogP of -1.30, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dihydroxy-6-oxocyclohexen-1-yl)acetamide is sourced from PubChem (CID 14609651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).