C19H28N2O2 — CID 146098026
(E)-4-(dimethylamino)-N-(3-hydroxypropyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)but-2-enamide (PubChem CID 146098026) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-(3-hydroxypropyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-(3-hydroxypropyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)but-2-enamide |
|---|---|
| PubChem CID | 146098026 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (E)-4-(dimethylamino)-N-(3-hydroxypropyl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)N(CCCO)C1CCCc2ccccc21 |
| InChI | InChI=1S/C19H28N2O2/c1-20(2)13-6-12-19(23)21(14-7-15-22)18-11-5-9-16-8-3-4-10-17(16)18/h3-4,6,8,10,12,18,22H,5,7,9,11,13-15H2,1-2H3/b12-6+ |
| InChIKey | FXDXZWGHXKPBJQ-WUXMJOGZSA-N |
| XLogP | 2.39 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|