C20H32O5 — CID 14609834
methyl (1R,2R,4aS,5S,8aR)-5-(methoxymethoxy)-1-methyl-2-(5-oxopentyl)-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 14609834) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is methyl (1R,2R,4aS,5S,8aR)-5-(methoxymethoxy)-1-methyl-2-(5-oxopentyl)-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1R,2R,4aS,5S,8aR)-5-(methoxymethoxy)-1-methyl-2-(5-oxopentyl)-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 14609834 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | methyl (1R,2R,4aS,5S,8aR)-5-(methoxymethoxy)-1-methyl-2-(5-oxopentyl)-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | COCO[C@H]1CCC[C@@H]2[C@@H]1C=C[C@@H](CCCCC=O)[C@@]2(C)C(=O)OC |
| InChI | InChI=1S/C20H32O5/c1-20(19(22)24-3)15(8-5-4-6-13-21)11-12-16-17(20)9-7-10-18(16)25-14-23-2/h11-13,15-18H,4-10,14H2,1-3H3/t15-,16+,17-,18+,20-/m1/s1 |
| InChIKey | UNHCICYQLOLKFD-IHEQNBGGSA-N |
| XLogP | 3.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|