C14H15ClN2O2 — CID 146098695
2-chloro-N-[1-(1,3-oxazol-2-yl)-2-phenylethyl]propanamide (PubChem CID 146098695) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 2-chloro-N-[1-(1,3-oxazol-2-yl)-2-phenylethyl]propanamide.
| Compound Name | 2-chloro-N-[1-(1,3-oxazol-2-yl)-2-phenylethyl]propanamide |
|---|---|
| PubChem CID | 146098695 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-chloro-N-[1-(1,3-oxazol-2-yl)-2-phenylethyl]propanamide |
| SMILES | CC(Cl)C(=O)NC(Cc1ccccc1)c1ncco1 |
| InChI | InChI=1S/C14H15ClN2O2/c1-10(15)13(18)17-12(14-16-7-8-19-14)9-11-5-3-2-4-6-11/h2-8,10,12H,9H2,1H3,(H,17,18) |
| InChIKey | KVLJMHUFDBLCKR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|