C13H15F3N4O3 — CID 146099553
methyl (E)-4-oxo-4-[[7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]but-2-enoate (PubChem CID 146099553) has the molecular formula C13H15F3N4O3 and a molecular weight of 332.28 g/mol. Its IUPAC name is methyl (E)-4-oxo-4-[[7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]but-2-enoate.
| Compound Name | methyl (E)-4-oxo-4-[[7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]but-2-enoate |
|---|---|
| PubChem CID | 146099553 |
| Molecular Formula | C13H15F3N4O3 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | methyl (E)-4-oxo-4-[[7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methylamino]but-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)NCc1nnc2n1CCC(C(F)(F)F)C2 |
| InChI | InChI=1S/C13H15F3N4O3/c1-23-12(22)3-2-11(21)17-7-10-19-18-9-6-8(13(14,15)16)4-5-20(9)10/h2-3,8H,4-7H2,1H3,(H,17,21)/b3-2+ |
| InChIKey | LLWWLCCRRUBPHH-NSCUHMNNSA-N |
| XLogP | 0.75 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|